C32H28N4O4 — CID 147214560
7-(2-methoxyethoxy)-3-methyl-4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-9H-indeno[2,1-c]pyridine-1-carboxamide (PubChem CID 147214560) has the molecular formula C32H28N4O4 and a molecular weight of 532.60 g/mol. Its IUPAC name is 7-(2-methoxyethoxy)-3-methyl-4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-9H-indeno[2,1-c]pyridine-1-carboxamide.
| Compound Name | 7-(2-methoxyethoxy)-3-methyl-4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-9H-indeno[2,1-c]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 147214560 |
| Molecular Formula | C32H28N4O4 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 7-(2-methoxyethoxy)-3-methyl-4-[2-methyl-3-(4-oxoquinazolin-3-yl)phenyl]-9H-indeno[2,1-c]pyridine-1-carboxamide |
| SMILES | COCCOc1ccc2c(c1)Cc1c(C(N)=O)nc(C)c(-c3cccc(-n4cnc5ccccc5c4=O)c3C)c1-2 |
| InChI | InChI=1S/C32H28N4O4/c1-18-22(8-6-10-27(18)36-17-34-26-9-5-4-7-24(26)32(36)38)28-19(2)35-30(31(33)37)25-16-20-15-21(40-14-13-39-3)11-12-23(20)29(25)28/h4-12,15,17H,13-14,16H2,1-3H3,(H2,33,37) |
| InChIKey | CFVZLTWLKBOADI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|