C16H14Cl4N4O5 — CID 157123026
methyl 2-amino-4,6-dichloropyridine-3-carboxylate;methyl 4,6-dichloro-2-(2-hydroxyethylideneamino)pyridine-3-carboxylate (PubChem CID 157123026) has the molecular formula C16H14Cl4N4O5 and a molecular weight of 484.12 g/mol. Its IUPAC name is methyl 2-amino-4,6-dichloropyridine-3-carboxylate;methyl 4,6-dichloro-2-(2-hydroxyethylideneamino)pyridine-3-carboxylate.
| Compound Name | methyl 2-amino-4,6-dichloropyridine-3-carboxylate;methyl 4,6-dichloro-2-(2-hydroxyethylideneamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 157123026 |
| Molecular Formula | C16H14Cl4N4O5 |
| Molecular Weight | 484.12 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | methyl 2-amino-4,6-dichloropyridine-3-carboxylate;methyl 4,6-dichloro-2-(2-hydroxyethylideneamino)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(Cl)cc(Cl)nc1N.COC(=O)c1c(Cl)cc(Cl)nc1N=CCO |
| InChI | InChI=1S/C9H8Cl2N2O3.C7H6Cl2N2O2/c1-16-9(15)7-5(10)4-6(11)13-8(7)12-2-3-14;1-13-7(12)5-3(8)2-4(9)11-6(5)10/h2,4,14H,3H2,1H3;2H,1H3,(H2,10,11) |
| InChIKey | AIERWZHDNUAOQC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.12 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|