C8H7Cl2N3O3 — CID 102484511
methyl 4,6-dichloro-2-[(hydroxyamino)methylideneamino]pyridine-3-carboxylate (PubChem CID 102484511) has the molecular formula C8H7Cl2N3O3 and a molecular weight of 264.07 g/mol. Its IUPAC name is methyl 4,6-dichloro-2-[(hydroxyamino)methylideneamino]pyridine-3-carboxylate.
| Compound Name | methyl 4,6-dichloro-2-[(hydroxyamino)methylideneamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102484511 |
| Molecular Formula | C8H7Cl2N3O3 |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | methyl 4,6-dichloro-2-[(hydroxyamino)methylideneamino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(Cl)cc(Cl)nc1N=CNO |
| InChI | InChI=1S/C8H7Cl2N3O3/c1-16-8(14)6-4(9)2-5(10)13-7(6)11-3-12-15/h2-3,15H,1H3,(H,11,12,13) |
| InChIKey | PUCFLPXMMXAZOB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|