About (2-phenylacetyl) 2-aminobenzoate
(2-phenylacetyl) 2-aminobenzoate (PubChem CID 157127364) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is (2-phenylacetyl) 2-aminobenzoate.
Molecular Properties
| Compound Name | (2-phenylacetyl) 2-aminobenzoate |
| PubChem CID | 157127364 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2-phenylacetyl) 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H13NO3/c16-13-9-5-4-8-12(13)15(18)19-14(17)10-11-6-2-1-3-7-11/h1-9H,10,16H2 |
| InChIKey | PKOYCUXZEVECOI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylacetyl) 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylacetyl) 2-aminobenzoate?
The IUPAC name of (2-phenylacetyl) 2-aminobenzoate (CID 157127364) is (2-phenylacetyl) 2-aminobenzoate.
What is the SMILES notation for (2-phenylacetyl) 2-aminobenzoate?
The canonical SMILES for (2-phenylacetyl) 2-aminobenzoate is Nc1ccccc1C(=O)OC(=O)Cc1ccccc1.
What is the InChIKey of (2-phenylacetyl) 2-aminobenzoate?
The InChIKey is PKOYCUXZEVECOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c16-13-9-5-4-8-12(13)15(18)19-14(17)10-11-6-2-1-3-7-11/h1-9H,10,16H2.
What are the key properties of (2-phenylacetyl) 2-aminobenzoate?
(2-phenylacetyl) 2-aminobenzoate has a molecular weight of 255.27 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylacetyl) 2-aminobenzoate is sourced from PubChem (CID 157127364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).