C29H28N4O5S — CID 157129577
N-[4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonyl-3-phenylmethoxypropanamide (PubChem CID 157129577) has the molecular formula C29H28N4O5S and a molecular weight of 544.63 g/mol. Its IUPAC name is N-[4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonyl-3-phenylmethoxypropanamide.
| Compound Name | N-[4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonyl-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 157129577 |
| Molecular Formula | C29H28N4O5S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-[4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonyl-3-phenylmethoxypropanamide |
| SMILES | Cc1ccc(-c2cnc(N)c(C(=O)Cc3ccc(S(=O)(=O)NC(=O)CCOCc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C29H28N4O5S/c1-20-7-11-23(12-8-20)25-18-31-29(30)28(32-25)26(34)17-21-9-13-24(14-10-21)39(36,37)33-27(35)15-16-38-19-22-5-3-2-4-6-22/h2-14,18H,15-17,19H2,1H3,(H2,30,31)(H,33,35) |
| InChIKey | APCYYHLEECUODN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|