C35H43N3O4 — CID 157133331
4-[(1E,3E,5Z)-5-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)penta-1,3-dienyl]-3-phenyl-1,2-oxazol-5-olate;2,4,4,6,6-pentamethylheptan-2-ylazanium (PubChem CID 157133331) has the molecular formula C35H43N3O4 and a molecular weight of 569.75 g/mol. Its IUPAC name is 4-[(1E,3E,5Z)-5-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)penta-1,3-dienyl]-3-phenyl-1,2-oxazol-5-olate;2,4,4,6,6-pentamethylheptan-2-ylazanium.
| Compound Name | 4-[(1E,3E,5Z)-5-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)penta-1,3-dienyl]-3-phenyl-1,2-oxazol-5-olate;2,4,4,6,6-pentamethylheptan-2-ylazanium |
|---|---|
| PubChem CID | 157133331 |
| Molecular Formula | C35H43N3O4 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | 4-[(1E,3E,5Z)-5-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)penta-1,3-dienyl]-3-phenyl-1,2-oxazol-5-olate;2,4,4,6,6-pentamethylheptan-2-ylazanium |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)[NH3+].O=C1ON=C(c2ccccc2)/C1=C/C=C/C=C/c1c(-c2ccccc2)noc1[O-] |
| InChI | InChI=1S/C23H16N2O4.C12H27N/c26-22-18(20(24-28-22)16-10-4-1-5-11-16)14-8-3-9-15-19-21(25-29-23(19)27)17-12-6-2-7-13-17;1-10(2,3)8-11(4,5)9-12(6,7)13/h1-15,26H;8-9,13H2,1-7H3/b9-3+,14-8+,19-15-; |
| InChIKey | AJIDZFNGTMGISW-PPDFRIDQSA-N |
| XLogP | 6.73 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|