C23H15N2O4- — CID 59905308
4-[(5Z)-5-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)penta-1,3-dienyl]-3-phenyl-1,2-oxazol-5-olate (PubChem CID 59905308) has the molecular formula C23H15N2O4- and a molecular weight of 383.38 g/mol. Its IUPAC name is 4-[(5Z)-5-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)penta-1,3-dienyl]-3-phenyl-1,2-oxazol-5-olate.
| Compound Name | 4-[(5Z)-5-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)penta-1,3-dienyl]-3-phenyl-1,2-oxazol-5-olate |
|---|---|
| PubChem CID | 59905308 |
| Molecular Formula | C23H15N2O4- |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 4-[(5Z)-5-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)penta-1,3-dienyl]-3-phenyl-1,2-oxazol-5-olate |
| SMILES | O=C1ON=C(c2ccccc2)/C1=C/C=CC=Cc1c(-c2ccccc2)noc1[O-] |
| InChI | InChI=1S/C23H16N2O4/c26-22-18(20(24-28-22)16-10-4-1-5-11-16)14-8-3-9-15-19-21(25-29-23(19)27)17-12-6-2-7-13-17/h1-15,26H/p-1/b9-3?,14-8?,19-15- |
| InChIKey | NEDZCQDBZLHEGJ-YZSQLPPASA-M |
| XLogP | 3.87 |
| TPSA | 87.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|