C43H53F3O10S2 — CID 157134779
(4-methylphenyl)-diphenylsulfanium;2-(4-oxatricyclo[4.2.1.03,7]nonan-2-yloxy)-2-oxoethanesulfonate;[1-oxo-1-(3,3,3-trifluoropropoxy)pentan-3-yl] 2,2-dimethylbutanoate (PubChem CID 157134779) has the molecular formula C43H53F3O10S2 and a molecular weight of 851.01 g/mol. Its IUPAC name is (4-methylphenyl)-diphenylsulfanium;2-(4-oxatricyclo[4.2.1.03,7]nonan-2-yloxy)-2-oxoethanesulfonate;[1-oxo-1-(3,3,3-trifluoropropoxy)pentan-3-yl] 2,2-dimethylbutanoate.
| Compound Name | (4-methylphenyl)-diphenylsulfanium;2-(4-oxatricyclo[4.2.1.03,7]nonan-2-yloxy)-2-oxoethanesulfonate;[1-oxo-1-(3,3,3-trifluoropropoxy)pentan-3-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 157134779 |
| Molecular Formula | C43H53F3O10S2 |
| Molecular Weight | 851.01 g/mol |
| Exact Mass | 850.30 |
| IUPAC Name | (4-methylphenyl)-diphenylsulfanium;2-(4-oxatricyclo[4.2.1.03,7]nonan-2-yloxy)-2-oxoethanesulfonate;[1-oxo-1-(3,3,3-trifluoropropoxy)pentan-3-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(CC(=O)OCCC(F)(F)F)OC(=O)C(C)(C)CC.Cc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=C(CS(=O)(=O)[O-])OC1C2CC3COC1C3C2 |
| InChI | InChI=1S/C19H17S.C14H23F3O4.C10H14O6S/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;1-5-10(21-12(19)13(3,4)6-2)9-11(18)20-8-7-14(15,16)17;11-8(4-17(12,13)14)16-9-5-1-6-3-15-10(9)7(6)2-5/h2-15H,1H3;10H,5-9H2,1-4H3;5-7,9-10H,1-4H2,(H,12,13,14)/q+1;;/p-1 |
| InChIKey | AJMODEIUBGZOOA-UHFFFAOYSA-M |
| XLogP | 8.22 |
| TPSA | 145.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.01 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|