C28H22F2O8S2 — CID 87679555
2-[(5,8-dioxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoro-2-oxoethanesulfonate;triphenylsulfanium (PubChem CID 87679555) has the molecular formula C28H22F2O8S2 and a molecular weight of 588.61 g/mol. Its IUPAC name is 2-[(5,8-dioxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoro-2-oxoethanesulfonate;triphenylsulfanium.
| Compound Name | 2-[(5,8-dioxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoro-2-oxoethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87679555 |
| Molecular Formula | C28H22F2O8S2 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | 2-[(5,8-dioxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoro-2-oxoethanesulfonate;triphenylsulfanium |
| SMILES | O=C1OC2C(OC(=O)C(F)(F)S(=O)(=O)[O-])C3CC1C2C3=O.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C10H8F2O8S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;11-10(12,21(16,17)18)9(15)20-6-3-1-2-4(5(3)13)7(6)19-8(2)14/h1-15H;2-4,6-7H,1H2,(H,16,17,18)/q+1;/p-1 |
| InChIKey | HYLHUUAWFUFYOF-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|