C21H23FN4O4S — CID 157134801
2-[(4aR,11bR)-2-amino-3,11b-dimethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-10-yl]-1-(5-fluoro-3-methyl-2-pyridinyl)ethanone (PubChem CID 157134801) has the molecular formula C21H23FN4O4S and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[(4aR,11bR)-2-amino-3,11b-dimethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-10-yl]-1-(5-fluoro-3-methyl-2-pyridinyl)ethanone.
| Compound Name | 2-[(4aR,11bR)-2-amino-3,11b-dimethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-10-yl]-1-(5-fluoro-3-methyl-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 157134801 |
| Molecular Formula | C21H23FN4O4S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-[(4aR,11bR)-2-amino-3,11b-dimethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-10-yl]-1-(5-fluoro-3-methyl-2-pyridinyl)ethanone |
| SMILES | Cc1cc(F)cnc1C(=O)Cc1ccc2c(c1)[C@@]1(C)N=C(N)N(C)S(=O)(=O)[C@@H]1CCO2 |
| InChI | InChI=1S/C21H23FN4O4S/c1-12-8-14(22)11-24-19(12)16(27)10-13-4-5-17-15(9-13)21(2)18(6-7-30-17)31(28,29)26(3)20(23)25-21/h4-5,8-9,11,18H,6-7,10H2,1-3H3,(H2,23,25)/t18-,21-/m1/s1 |
| InChIKey | GGVOPTUDTNMRLD-WIYYLYMNSA-N |
| XLogP | 1.91 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |