C18H27N3O2S — CID 160882900
(11bR)-10-butyl-3,11b-dimethyl-4-methylidene-4-oxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-2-amine (PubChem CID 160882900) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (11bR)-10-butyl-3,11b-dimethyl-4-methylidene-4-oxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-2-amine.
| Compound Name | (11bR)-10-butyl-3,11b-dimethyl-4-methylidene-4-oxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-2-amine |
|---|---|
| PubChem CID | 160882900 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (11bR)-10-butyl-3,11b-dimethyl-4-methylidene-4-oxo-5,6-dihydro-4aH-[1]benzoxepino[5,4-e][1,2,4]thiadiazin-2-amine |
| SMILES | C=S1(=O)C2CCOc3ccc(CCCC)cc3[C@@]2(C)N=C(N)N1C |
| InChI | InChI=1S/C18H27N3O2S/c1-5-6-7-13-8-9-15-14(12-13)18(2)16(10-11-23-15)24(4,22)21(3)17(19)20-18/h8-9,12,16H,4-7,10-11H2,1-3H3,(H2,19,20)/t16?,18-,24?/m1/s1 |
| InChIKey | KRHGQAPNAWHHDL-COYKAVQBSA-N |
| XLogP | 2.29 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|