C27H25ClN2O3 — CID 157137286
N-(3-chloro-4-methylphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide (PubChem CID 157137286) has the molecular formula C27H25ClN2O3 and a molecular weight of 460.96 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide |
|---|---|
| PubChem CID | 157137286 |
| Molecular Formula | C27H25ClN2O3 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide |
| SMILES | COc1ccc2cc(CCc3ccccc3)c(=O)n(CC(=O)Nc3ccc(C)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C27H25ClN2O3/c1-18-8-12-22(15-24(18)28)29-26(31)17-30-25-16-23(33-2)13-11-20(25)14-21(27(30)32)10-9-19-6-4-3-5-7-19/h3-8,11-16H,9-10,17H2,1-2H3,(H,29,31) |
| InChIKey | AJTPDWDLLMVQMR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |