C28H28N2O3 — CID 161418456
N-(4-ethylphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide (PubChem CID 161418456) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide |
|---|---|
| PubChem CID | 161418456 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-(4-ethylphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide |
| SMILES | CCc1ccc(NC(=O)Cn2c(=O)c(CCc3ccccc3)cc3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C28H28N2O3/c1-3-20-10-14-24(15-11-20)29-27(31)19-30-26-18-25(33-2)16-13-22(26)17-23(28(30)32)12-9-21-7-5-4-6-8-21/h4-8,10-11,13-18H,3,9,12,19H2,1-2H3,(H,29,31) |
| InChIKey | VWKHNKALTXOPTD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |