C27H25ClN2O4 — CID 160506977
N-(5-chloro-2-methoxyphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide (PubChem CID 160506977) has the molecular formula C27H25ClN2O4 and a molecular weight of 476.96 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide |
|---|---|
| PubChem CID | 160506977 |
| Molecular Formula | C27H25ClN2O4 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[7-methoxy-2-oxo-3-(2-phenylethyl)quinolin-1-yl]acetamide |
| SMILES | COc1ccc2cc(CCc3ccccc3)c(=O)n(CC(=O)Nc3cc(Cl)ccc3OC)c2c1 |
| InChI | InChI=1S/C27H25ClN2O4/c1-33-22-12-10-19-14-20(9-8-18-6-4-3-5-7-18)27(32)30(24(19)16-22)17-26(31)29-23-15-21(28)11-13-25(23)34-2/h3-7,10-16H,8-9,17H2,1-2H3,(H,29,31) |
| InChIKey | QSNRLHCAIQIRSN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |