C28H39N5O — CID 157138238
4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)cyclohexane-1-carbonitrile;1-[3-(5,6,7,8-tetrahydroindolizin-8-yl)pyrrolidin-1-yl]ethanone (PubChem CID 157138238) has the molecular formula C28H39N5O and a molecular weight of 461.65 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)cyclohexane-1-carbonitrile;1-[3-(5,6,7,8-tetrahydroindolizin-8-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)cyclohexane-1-carbonitrile;1-[3-(5,6,7,8-tetrahydroindolizin-8-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 157138238 |
| Molecular Formula | C28H39N5O |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.32 |
| IUPAC Name | 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)cyclohexane-1-carbonitrile;1-[3-(5,6,7,8-tetrahydroindolizin-8-yl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C2CCCn3cccc32)C1.N#CC1CCC(C2CCCc3cncn32)CC1 |
| InChI | InChI=1S/C14H19N3.C14H20N2O/c15-8-11-4-6-12(7-5-11)14-3-1-2-13-9-16-10-17(13)14;1-11(17)16-9-6-12(10-16)13-4-2-7-15-8-3-5-14(13)15/h9-12,14H,1-7H2;3,5,8,12-13H,2,4,6-7,9-10H2,1H3 |
| InChIKey | AJWNAESHVDNYBO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |