C10H13BN — CID 162267020
CID 162267020 (PubChem CID 162267020) has the molecular formula C10H13BN and a molecular weight of 158.03 g/mol.
| Compound Name | CID 162267020 |
|---|---|
| PubChem CID | 162267020 |
| Molecular Formula | C10H13BN |
| Molecular Weight | 158.03 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | — |
| SMILES | [B].c1cc2n(c1)CC1CCCC21 |
| InChI | InChI=1S/C10H13N.B/c1-3-8-7-11-6-2-5-10(11)9(8)4-1;/h2,5-6,8-9H,1,3-4,7H2; |
| InChIKey | BPAQSCVVZAISNC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.03 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|