C9H11NO — CID 130026124
5,6,7,8-tetrahydroindolizine-8-carbaldehyde (PubChem CID 130026124) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroindolizine-8-carbaldehyde.
| Compound Name | 5,6,7,8-tetrahydroindolizine-8-carbaldehyde |
|---|---|
| PubChem CID | 130026124 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 5,6,7,8-tetrahydroindolizine-8-carbaldehyde |
| SMILES | O=CC1CCCn2cccc21 |
| InChI | InChI=1S/C9H11NO/c11-7-8-3-1-5-10-6-2-4-9(8)10/h2,4,6-8H,1,3,5H2 |
| InChIKey | FUPNPYGFFSLNEV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|