About N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine
N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine (PubChem CID 157139644) has the molecular formula C11H30N2Si
and a molecular weight of 218.46 g/mol. Its IUPAC name is N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine.
Molecular Properties
| Compound Name | N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine |
| PubChem CID | 157139644 |
| Molecular Formula | C11H30N2Si |
| Molecular Weight | 218.46 g/mol |
| Exact Mass | 218.22 |
| IUPAC Name | N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine |
| SMILES | CCN(CC)[Si](C)(C)C.CCNCC |
| InChI | InChI=1S/C7H19NSi.C4H11N/c1-6-8(7-2)9(3,4)5;1-3-5-4-2/h6-7H2,1-5H3;5H,3-4H2,1-2H3 |
| InChIKey | AKAUHDUSPNHZRA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine?
The IUPAC name of N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine (CID 157139644) is N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine.
What is the SMILES notation for N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine?
The canonical SMILES for N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine is CCN(CC)[Si](C)(C)C.CCNCC.
What is the InChIKey of N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine?
The InChIKey is AKAUHDUSPNHZRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H19NSi.C4H11N/c1-6-8(7-2)9(3,4)5;1-3-5-4-2/h6-7H2,1-5H3;5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine?
N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine has a molecular weight of 218.46 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;N-ethyl-N-trimethylsilylethanamine is sourced from PubChem (CID 157139644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).