About 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate
1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate (PubChem CID 157142178) has the molecular formula C18H14F6O4
and a molecular weight of 408.29 g/mol. Its IUPAC name is 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate.
Molecular Properties
| Compound Name | 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate |
| PubChem CID | 157142178 |
| Molecular Formula | C18H14F6O4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(F)(F)F.CC(=O)c1ccc(O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/2C9H7F3O2/c1-5(13)6-2-3-8(14)7(4-6)9(10,11)12;1-6(13)14-8-5-3-2-4-7(8)9(10,11)12/h2-4,14H,1H3;2-5H,1H3 |
| InChIKey | AKHSTCPTGSJIOQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate?
The IUPAC name of 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate (CID 157142178) is 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate.
What is the SMILES notation for 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate?
The canonical SMILES for 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate is CC(=O)Oc1ccccc1C(F)(F)F.CC(=O)c1ccc(O)c(C(F)(F)F)c1.
What is the InChIKey of 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate?
The InChIKey is AKHSTCPTGSJIOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7F3O2/c1-5(13)6-2-3-8(14)7(4-6)9(10,11)12;1-6(13)14-8-5-3-2-4-7(8)9(10,11)12/h2-4,14H,1H3;2-5H,1H3.
What are the key properties of 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate?
1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate has a molecular weight of 408.29 g/mol, XLogP of 5.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone;[2-(trifluoromethyl)phenyl] acetate is sourced from PubChem (CID 157142178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).