C21H12F3IO4 — CID 20540489
4-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,4-dicarboxylate (PubChem CID 20540489) has the molecular formula C21H12F3IO4 and a molecular weight of 512.22 g/mol. Its IUPAC name is 4-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 20540489 |
| Molecular Formula | C21H12F3IO4 |
| Molecular Weight | 512.22 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | 4-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,4-dicarboxylate |
| SMILES | O=C(Oc1ccccc1I)c1ccc(C(=O)Oc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H12F3IO4/c22-21(23,24)15-5-1-3-7-17(15)28-19(26)13-9-11-14(12-10-13)20(27)29-18-8-4-2-6-16(18)25/h1-12H |
| InChIKey | WATWIYLHZZMHBT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.22 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|