C33H67N3O2 — CID 157145997
acetamide;2-(dimethylamino)-N-[(Z)-heptacos-18-en-10-yl]acetamide (PubChem CID 157145997) has the molecular formula C33H67N3O2 and a molecular weight of 537.92 g/mol. Its IUPAC name is acetamide;2-(dimethylamino)-N-[(Z)-heptacos-18-en-10-yl]acetamide.
| Compound Name | acetamide;2-(dimethylamino)-N-[(Z)-heptacos-18-en-10-yl]acetamide |
|---|---|
| PubChem CID | 157145997 |
| Molecular Formula | C33H67N3O2 |
| Molecular Weight | 537.92 g/mol |
| Exact Mass | 537.52 |
| IUPAC Name | acetamide;2-(dimethylamino)-N-[(Z)-heptacos-18-en-10-yl]acetamide |
| SMILES | CC(N)=O.CCCCCCCC/C=C\CCCCCCCC(CCCCCCCCC)NC(=O)CN(C)C |
| InChI | InChI=1S/C31H62N2O.C2H5NO/c1-5-7-9-11-13-14-15-16-17-18-19-20-22-24-26-28-30(32-31(34)29-33(3)4)27-25-23-21-12-10-8-6-2;1-2(3)4/h16-17,30H,5-15,18-29H2,1-4H3,(H,32,34);1H3,(H2,3,4)/b17-16-; |
| InChIKey | AKSBOLQQHRUUDM-XYJRJTJESA-N |
| XLogP | 8.70 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.92 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|