C21H42N2O — CID 139476661
(E)-4-(dimethylamino)-N-pentadecan-8-ylbut-2-enamide (PubChem CID 139476661) has the molecular formula C21H42N2O and a molecular weight of 338.58 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-pentadecan-8-ylbut-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-pentadecan-8-ylbut-2-enamide |
|---|---|
| PubChem CID | 139476661 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | (E)-4-(dimethylamino)-N-pentadecan-8-ylbut-2-enamide |
| SMILES | CCCCCCCC(CCCCCCC)NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C21H42N2O/c1-5-7-9-11-13-16-20(17-14-12-10-8-6-2)22-21(24)18-15-19-23(3)4/h15,18,20H,5-14,16-17,19H2,1-4H3,(H,22,24)/b18-15+ |
| InChIKey | HJJMOLIZKPKZET-OBGWFSINSA-N |
| XLogP | 5.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|