C12H19N5 — CID 157151386
6-N,4-dimethyl-6-N-[(5-methylcyclopenta-1,4-dien-1-yl)methyl]-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 157151386) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 6-N,4-dimethyl-6-N-[(5-methylcyclopenta-1,4-dien-1-yl)methyl]-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 6-N,4-dimethyl-6-N-[(5-methylcyclopenta-1,4-dien-1-yl)methyl]-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 157151386 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 6-N,4-dimethyl-6-N-[(5-methylcyclopenta-1,4-dien-1-yl)methyl]-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CC1=CCC=C1CN(C)C1=NC(C)N=C(N)N1 |
| InChI | InChI=1S/C12H19N5/c1-8-5-4-6-10(8)7-17(3)12-15-9(2)14-11(13)16-12/h5-6,9H,4,7H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | JNSJPRJGLIVDSA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |