About methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene
methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene (PubChem CID 157153171) has the molecular formula C21H30N2O4
and a molecular weight of 374.48 g/mol. Its IUPAC name is methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene.
Molecular Properties
| Compound Name | methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene |
| PubChem CID | 157153171 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene |
| SMILES | C/N=C/OOC.CNC(=O)OC.Cc1cccc(Cc2cccc(C)c2)c1 |
| InChI | InChI=1S/C15H16.2C3H7NO2/c1-12-5-3-7-14(9-12)11-15-8-4-6-13(2)10-15;1-4-3(5)6-2;1-4-3-6-5-2/h3-10H,11H2,1-2H3;1-2H3,(H,4,5);3H,1-2H3/b;;4-3+ |
| InChIKey | ALMNEDPAAKTAOL-VJJINTEWSA-N |
| XLogP | 4.09 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene?
The IUPAC name of methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene (CID 157153171) is methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene.
What is the SMILES notation for methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene?
The canonical SMILES for methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene is C/N=C/OOC.CNC(=O)OC.Cc1cccc(Cc2cccc(C)c2)c1.
What is the InChIKey of methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene?
The InChIKey is ALMNEDPAAKTAOL-VJJINTEWSA-N. The full InChI is InChI=1S/C15H16.2C3H7NO2/c1-12-5-3-7-14(9-12)11-15-8-4-6-13(2)10-15;1-4-3(5)6-2;1-4-3-6-5-2/h3-10H,11H2,1-2H3;1-2H3,(H,4,5);3H,1-2H3/b;;4-3+.
What are the key properties of methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene?
methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene has a molecular weight of 374.48 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy N-methylmethanimidate;methyl N-methylcarbamate;1-methyl-3-[(3-methylphenyl)methyl]benzene is sourced from PubChem (CID 157153171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).