C17H14ClNO — CID 157156867
(3R)-8-chloro-3-methyl-1-phenyl-3,5-dihydro-2-benzazepin-4-one (PubChem CID 157156867) has the molecular formula C17H14ClNO and a molecular weight of 283.76 g/mol. Its IUPAC name is (3R)-8-chloro-3-methyl-1-phenyl-3,5-dihydro-2-benzazepin-4-one.
| Compound Name | (3R)-8-chloro-3-methyl-1-phenyl-3,5-dihydro-2-benzazepin-4-one |
|---|---|
| PubChem CID | 157156867 |
| Molecular Formula | C17H14ClNO |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (3R)-8-chloro-3-methyl-1-phenyl-3,5-dihydro-2-benzazepin-4-one |
| SMILES | C[C@H]1N=C(c2ccccc2)c2cc(Cl)ccc2CC1=O |
| InChI | InChI=1S/C17H14ClNO/c1-11-16(20)9-13-7-8-14(18)10-15(13)17(19-11)12-5-3-2-4-6-12/h2-8,10-11H,9H2,1H3/t11-/m1/s1 |
| InChIKey | ALXIHWXMYLPSEO-LLVKDONJSA-N |
| XLogP | 3.69 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |