C13H25NO5 — CID 157158561
2-(tert-butylamino)-8-hydroxy-7-(hydroxymethyl)-5-oxooctanoic acid (PubChem CID 157158561) has the molecular formula C13H25NO5 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(tert-butylamino)-8-hydroxy-7-(hydroxymethyl)-5-oxooctanoic acid.
| Compound Name | 2-(tert-butylamino)-8-hydroxy-7-(hydroxymethyl)-5-oxooctanoic acid |
|---|---|
| PubChem CID | 157158561 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-(tert-butylamino)-8-hydroxy-7-(hydroxymethyl)-5-oxooctanoic acid |
| SMILES | CC(C)(C)NC(CCC(=O)CC(CO)CO)C(=O)O |
| InChI | InChI=1S/C13H25NO5/c1-13(2,3)14-11(12(18)19)5-4-10(17)6-9(7-15)8-16/h9,11,14-16H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | HWLUZHSYDWRJAQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |