C26H22FN3O3S2 — CID 157160197
4-[(2R)-4-[5-cyclopropyl-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide (PubChem CID 157160197) has the molecular formula C26H22FN3O3S2 and a molecular weight of 507.61 g/mol. Its IUPAC name is 4-[(2R)-4-[5-cyclopropyl-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide.
| Compound Name | 4-[(2R)-4-[5-cyclopropyl-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 157160197 |
| Molecular Formula | C26H22FN3O3S2 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 4-[(2R)-4-[5-cyclopropyl-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide |
| SMILES | C[C@H](CC(=O)c1nc(-c2ncc(-c3ccc(F)cc3)s2)sc1C1CC1)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C26H22FN3O3S2/c1-14(15-2-6-18(7-3-15)24(32)30-33)12-20(31)22-23(17-4-5-17)35-26(29-22)25-28-13-21(34-25)16-8-10-19(27)11-9-16/h2-3,6-11,13-14,17,33H,4-5,12H2,1H3,(H,30,32)/t14-/m1/s1 |
| InChIKey | AMGYXAOQYLBYAC-CQSZACIVSA-N |
| XLogP | 6.45 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|