About [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate
[1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate (PubChem CID 157161269) has the molecular formula C9H18NO4S+
and a molecular weight of 236.31 g/mol. Its IUPAC name is [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate.
Molecular Properties
| Compound Name | [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate |
| PubChem CID | 157161269 |
| Molecular Formula | C9H18NO4S+ |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate |
| SMILES | C=S(C)(=O)OC[N+]1(OC(C)=O)CCCC1 |
| InChI | InChI=1S/C9H18NO4S/c1-9(11)14-10(6-4-5-7-10)8-13-15(2,3)12/h2,4-8H2,1,3H3/q+1 |
| InChIKey | URJLFERMCRFXIJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate?
The IUPAC name of [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate (CID 157161269) is [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate.
What is the SMILES notation for [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate?
The canonical SMILES for [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate is C=S(C)(=O)OC[N+]1(OC(C)=O)CCCC1.
What is the InChIKey of [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate?
The InChIKey is URJLFERMCRFXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO4S/c1-9(11)14-10(6-4-5-7-10)8-13-15(2,3)12/h2,4-8H2,1,3H3/q+1.
What are the key properties of [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate?
[1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate has a molecular weight of 236.31 g/mol, XLogP of 0.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(methyl-methylidene-oxo-λ6-sulfanyl)oxymethyl]pyrrolidin-1-ium-1-yl] acetate is sourced from PubChem (CID 157161269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).