C13H23NO7S — CID 10830766
ethyl (2R,6S)-2-(acetyloxymethyl)-6-(methylsulfonyloxymethyl)piperidine-1-carboxylate (PubChem CID 10830766) has the molecular formula C13H23NO7S and a molecular weight of 337.39 g/mol. Its IUPAC name is ethyl (2R,6S)-2-(acetyloxymethyl)-6-(methylsulfonyloxymethyl)piperidine-1-carboxylate.
| Compound Name | ethyl (2R,6S)-2-(acetyloxymethyl)-6-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10830766 |
| Molecular Formula | C13H23NO7S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | ethyl (2R,6S)-2-(acetyloxymethyl)-6-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1[C@@H](COC(C)=O)CCC[C@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C13H23NO7S/c1-4-19-13(16)14-11(8-20-10(2)15)6-5-7-12(14)9-21-22(3,17)18/h11-12H,4-9H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | QRFHUWQFJDFCRS-NEPJUHHUSA-N |
| XLogP | 0.91 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|