C23H26ClN5O2 — CID 157161500
4-[8-[4-[(2-chloropyrimidin-4-yl)methyl]cyclohexyl]oxyquinoxalin-6-yl]morpholine (PubChem CID 157161500) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is 4-[8-[4-[(2-chloropyrimidin-4-yl)methyl]cyclohexyl]oxyquinoxalin-6-yl]morpholine.
| Compound Name | 4-[8-[4-[(2-chloropyrimidin-4-yl)methyl]cyclohexyl]oxyquinoxalin-6-yl]morpholine |
|---|---|
| PubChem CID | 157161500 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4-[8-[4-[(2-chloropyrimidin-4-yl)methyl]cyclohexyl]oxyquinoxalin-6-yl]morpholine |
| SMILES | Clc1nccc(CC2CCC(Oc3cc(N4CCOCC4)cc4nccnc34)CC2)n1 |
| InChI | InChI=1S/C23H26ClN5O2/c24-23-27-6-5-17(28-23)13-16-1-3-19(4-2-16)31-21-15-18(29-9-11-30-12-10-29)14-20-22(21)26-8-7-25-20/h5-8,14-16,19H,1-4,9-13H2 |
| InChIKey | AMKUYEXPIRSKEO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |