C24H29N5O2 — CID 158858413
4-[8-[4-[(2-methylpyrimidin-5-yl)methyl]cyclohexyl]oxyquinoxalin-6-yl]morpholine (PubChem CID 158858413) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[8-[4-[(2-methylpyrimidin-5-yl)methyl]cyclohexyl]oxyquinoxalin-6-yl]morpholine.
| Compound Name | 4-[8-[4-[(2-methylpyrimidin-5-yl)methyl]cyclohexyl]oxyquinoxalin-6-yl]morpholine |
|---|---|
| PubChem CID | 158858413 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 4-[8-[4-[(2-methylpyrimidin-5-yl)methyl]cyclohexyl]oxyquinoxalin-6-yl]morpholine |
| SMILES | Cc1ncc(CC2CCC(Oc3cc(N4CCOCC4)cc4nccnc34)CC2)cn1 |
| InChI | InChI=1S/C24H29N5O2/c1-17-27-15-19(16-28-17)12-18-2-4-21(5-3-18)31-23-14-20(29-8-10-30-11-9-29)13-22-24(23)26-7-6-25-22/h6-7,13-16,18,21H,2-5,8-12H2,1H3 |
| InChIKey | JAIUKXLKHQOZJA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |