About ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide
ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide (PubChem CID 157169201) has the molecular formula C20H16N8O3S2
and a molecular weight of 480.54 g/mol. Its IUPAC name is ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide.
Molecular Properties
| Compound Name | ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide |
| PubChem CID | 157169201 |
| Molecular Formula | C20H16N8O3S2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide |
| SMILES | CCOC(=O)Nc1nnsc1-c1ccccc1.[N-]=[N+]=NC(=O)c1nnsc1-c1ccccc1 |
| InChI | InChI=1S/C11H11N3O2S.C9H5N5OS/c1-2-16-11(15)12-10-9(17-14-13-10)8-6-4-3-5-7-8;10-13-12-9(15)7-8(16-14-11-7)6-4-2-1-3-5-6/h3-7H,2H2,1H3,(H,12,15);1-5H |
| InChIKey | ANGKLDQBHSVOKC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 155.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide?
The IUPAC name of ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide (CID 157169201) is ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide.
What is the SMILES notation for ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide?
The canonical SMILES for ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide is CCOC(=O)Nc1nnsc1-c1ccccc1.[N-]=[N+]=NC(=O)c1nnsc1-c1ccccc1.
What is the InChIKey of ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide?
The InChIKey is ANGKLDQBHSVOKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2S.C9H5N5OS/c1-2-16-11(15)12-10-9(17-14-13-10)8-6-4-3-5-7-8;10-13-12-9(15)7-8(16-14-11-7)6-4-2-1-3-5-6/h3-7H,2H2,1H3,(H,12,15);1-5H.
What are the key properties of ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide?
ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide has a molecular weight of 480.54 g/mol, XLogP of 5.43, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(5-phenylthiadiazol-4-yl)carbamate;5-phenylthiadiazole-4-carbonyl azide is sourced from PubChem (CID 157169201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).