C20H27ClN4O3S2 — CID 157174013
3-[6-(5-chlorothiophen-2-yl)-3-pyridinyl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea;ethene (PubChem CID 157174013) has the molecular formula C20H27ClN4O3S2 and a molecular weight of 471.05 g/mol. Its IUPAC name is 3-[6-(5-chlorothiophen-2-yl)-3-pyridinyl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea;ethene.
| Compound Name | 3-[6-(5-chlorothiophen-2-yl)-3-pyridinyl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea;ethene |
|---|---|
| PubChem CID | 157174013 |
| Molecular Formula | C20H27ClN4O3S2 |
| Molecular Weight | 471.05 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 3-[6-(5-chlorothiophen-2-yl)-3-pyridinyl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea;ethene |
| SMILES | C=C.CCS(=O)(=O)N1CCC(N(C)C(=O)Nc2ccc(-c3ccc(Cl)s3)nc2)CC1 |
| InChI | InChI=1S/C18H23ClN4O3S2.C2H4/c1-3-28(25,26)23-10-8-14(9-11-23)22(2)18(24)21-13-4-5-15(20-12-13)16-6-7-17(19)27-16;1-2/h4-7,12,14H,3,8-11H2,1-2H3,(H,21,24);1-2H2 |
| InChIKey | ANUJSOSPNDBLCN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.05 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|