C16H30 — CID 157176736
4,4-dimethylpent-2-yne;2,3,4,4-tetramethylpent-2-ene (PubChem CID 157176736) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 4,4-dimethylpent-2-yne;2,3,4,4-tetramethylpent-2-ene.
| Compound Name | 4,4-dimethylpent-2-yne;2,3,4,4-tetramethylpent-2-ene |
|---|---|
| PubChem CID | 157176736 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 4,4-dimethylpent-2-yne;2,3,4,4-tetramethylpent-2-ene |
| SMILES | CC#CC(C)(C)C.CC(C)=C(C)C(C)(C)C |
| InChI | InChI=1S/C9H18.C7H12/c1-7(2)8(3)9(4,5)6;1-5-6-7(2,3)4/h1-6H3;1-4H3 |
| InChIKey | AOCDUMHNOHADIY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|