About 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid
3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid (PubChem CID 157183023) has the molecular formula C21H27NO4S
and a molecular weight of 389.52 g/mol. Its IUPAC name is 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid.
Molecular Properties
| Compound Name | 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid |
| PubChem CID | 157183023 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid |
| SMILES | CCc1ccccc1SC(CCNC)c1ccccc1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C18H23NS.C3H4O4/c1-3-15-9-7-8-12-17(15)20-18(13-14-19-2)16-10-5-4-6-11-16;4-2(5)1-3(6)7/h4-12,18-19H,3,13-14H2,1-2H3;1H2,(H,4,5)(H,6,7) |
| InChIKey | AOTZWXZIPCEXRA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid?
The IUPAC name of 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid (CID 157183023) is 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid.
What is the SMILES notation for 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid?
The canonical SMILES for 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid is CCc1ccccc1SC(CCNC)c1ccccc1.O=C(O)CC(=O)O.
What is the InChIKey of 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid?
The InChIKey is AOTZWXZIPCEXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NS.C3H4O4/c1-3-15-9-7-8-12-17(15)20-18(13-14-19-2)16-10-5-4-6-11-16;4-2(5)1-3(6)7/h4-12,18-19H,3,13-14H2,1-2H3;1H2,(H,4,5)(H,6,7).
What are the key properties of 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid?
3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid has a molecular weight of 389.52 g/mol, XLogP of 4.24, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylphenyl)sulfanyl-N-methyl-3-phenylpropan-1-amine;propanedioic acid is sourced from PubChem (CID 157183023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).