C18H25NOS2 — CID 19865603
3-(2-ethoxyphenyl)sulfanyl-3-(4-ethylthiophen-3-yl)-N-methylpropan-1-amine (PubChem CID 19865603) has the molecular formula C18H25NOS2 and a molecular weight of 335.54 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)sulfanyl-3-(4-ethylthiophen-3-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(2-ethoxyphenyl)sulfanyl-3-(4-ethylthiophen-3-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 19865603 |
| Molecular Formula | C18H25NOS2 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-(2-ethoxyphenyl)sulfanyl-3-(4-ethylthiophen-3-yl)-N-methylpropan-1-amine |
| SMILES | CCOc1ccccc1SC(CCNC)c1cscc1CC |
| InChI | InChI=1S/C18H25NOS2/c1-4-14-12-21-13-15(14)17(10-11-19-3)22-18-9-7-6-8-16(18)20-5-2/h6-9,12-13,17,19H,4-5,10-11H2,1-3H3 |
| InChIKey | SIZPYZXQDXCNLX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |