C12H10O4Zn — CID 157183877
zinc;benzene-1,2-diol;benzene-1,2-diolate (PubChem CID 157183877) has the molecular formula C12H10O4Zn and a molecular weight of 283.60 g/mol. Its IUPAC name is zinc;benzene-1,2-diol;benzene-1,2-diolate.
| Compound Name | zinc;benzene-1,2-diol;benzene-1,2-diolate |
|---|---|
| PubChem CID | 157183877 |
| Molecular Formula | C12H10O4Zn |
| Molecular Weight | 283.60 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | zinc;benzene-1,2-diol;benzene-1,2-diolate |
| SMILES | Oc1ccccc1O.[O-]c1ccccc1[O-].[Zn+2] |
| InChI | InChI=1S/2C6H6O2.Zn/c2*7-5-3-1-2-4-6(5)8;/h2*1-4,7-8H;/q;;+2/p-2 |
| InChIKey | AOWPHZCFOWTGCH-UHFFFAOYSA-L |
| XLogP | 0.93 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.60 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|