C25H24ClF3N6 — CID 157186830
(9S)-5-chloro-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene;(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 157186830) has the molecular formula C25H24ClF3N6 and a molecular weight of 500.96 g/mol. Its IUPAC name is (9S)-5-chloro-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene;(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (9S)-5-chloro-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene;(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 157186830 |
| Molecular Formula | C25H24ClF3N6 |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (9S)-5-chloro-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene;(9S)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | Clc1ccc2c(n1)N[C@H]1CCN2C1.FC(F)(F)c1cccc(-c2ccc3c(n2)N[C@H]2CCN3C2)c1 |
| InChI | InChI=1S/C16H14F3N3.C9H10ClN3/c17-16(18,19)11-3-1-2-10(8-11)13-4-5-14-15(21-13)20-12-6-7-22(14)9-12;10-8-2-1-7-9(12-8)11-6-3-4-13(7)5-6/h1-5,8,12H,6-7,9H2,(H,20,21);1-2,6H,3-5H2,(H,11,12)/t12-;6-/m00/s1 |
| InChIKey | APFIEFGXNVDRLH-PRNXVQILSA-N |
| XLogP | 5.51 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|