C20H31NO3 — CID 157189101
1,1,2,3,4,4,6,6,7,7-decadeuterio-10-methoxy-3-[1,1,3,3,3-pentadeuterio-2-methyl-2-(trideuteriomethyl)propyl]-9-(trideuteriomethoxy)-11bH-benzo[a]quinolizin-2-ol (PubChem CID 157189101) has the molecular formula C20H31NO3 and a molecular weight of 354.60 g/mol. Its IUPAC name is 1,1,2,3,4,4,6,6,7,7-decadeuterio-10-methoxy-3-[1,1,3,3,3-pentadeuterio-2-methyl-2-(trideuteriomethyl)propyl]-9-(trideuteriomethoxy)-11bH-benzo[a]quinolizin-2-ol.
| Compound Name | 1,1,2,3,4,4,6,6,7,7-decadeuterio-10-methoxy-3-[1,1,3,3,3-pentadeuterio-2-methyl-2-(trideuteriomethyl)propyl]-9-(trideuteriomethoxy)-11bH-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 157189101 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.36 |
| IUPAC Name | 1,1,2,3,4,4,6,6,7,7-decadeuterio-10-methoxy-3-[1,1,3,3,3-pentadeuterio-2-methyl-2-(trideuteriomethyl)propyl]-9-(trideuteriomethoxy)-11bH-benzo[a]quinolizin-2-ol |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1OC)C1N(C([2H])([2H])C2([2H])[2H])C([2H])([2H])C([2H])(C([2H])([2H])C(C)(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])(O)C1([2H])[2H] |
| InChI | InChI=1S/C20H31NO3/c1-20(2,3)11-14-12-21-7-6-13-8-18(23-4)19(24-5)9-15(13)16(21)10-17(14)22/h8-9,14,16-17,22H,6-7,10-12H2,1-5H3/i1D3,2D3,4D3,6D2,7D2,10D2,11D2,12D2,14D,17D |
| InChIKey | QYIUGLDNEJATFW-LHLOUKEKSA-N |
| XLogP | 3.42 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |