C19H27NO4 — CID 162068798
(3S,11bS)-4,4,6,6,7,7-hexadeuterio-10-methoxy-3-(1,1,3,3,3-pentadeuterio-2-hydroxy-2-methylpropyl)-9-(trideuteriomethoxy)-3,11b-dihydro-1H-benzo[a]quinolizin-2-one (PubChem CID 162068798) has the molecular formula C19H27NO4 and a molecular weight of 347.51 g/mol. Its IUPAC name is (3S,11bS)-4,4,6,6,7,7-hexadeuterio-10-methoxy-3-(1,1,3,3,3-pentadeuterio-2-hydroxy-2-methylpropyl)-9-(trideuteriomethoxy)-3,11b-dihydro-1H-benzo[a]quinolizin-2-one.
| Compound Name | (3S,11bS)-4,4,6,6,7,7-hexadeuterio-10-methoxy-3-(1,1,3,3,3-pentadeuterio-2-hydroxy-2-methylpropyl)-9-(trideuteriomethoxy)-3,11b-dihydro-1H-benzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 162068798 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | (3S,11bS)-4,4,6,6,7,7-hexadeuterio-10-methoxy-3-(1,1,3,3,3-pentadeuterio-2-hydroxy-2-methylpropyl)-9-(trideuteriomethoxy)-3,11b-dihydro-1H-benzo[a]quinolizin-2-one |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1OC)[C@@H]1CC(=O)[C@@H](C([2H])([2H])C(C)(O)C([2H])([2H])[2H])C([2H])([2H])N1C([2H])([2H])C2([2H])[2H] |
| InChI | InChI=1S/C19H27NO4/c1-19(2,22)10-13-11-20-6-5-12-7-17(23-3)18(24-4)8-14(12)15(20)9-16(13)21/h7-8,13,15,22H,5-6,9-11H2,1-4H3/t13-,15-/m0/s1/i1D3,3D3,5D2,6D2,10D2,11D2/t13-,15-,19? |
| InChIKey | WSSKRNHJTRPOTQ-CYWHRXGLSA-N |
| XLogP | 2.35 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |