C20H29NO3 — CID 158668747
(3S,11bS)-1,1,3,4,4,6,6,7,7-nonadeuterio-3-(2,2-dimethylpropyl)-9,10-bis(trideuteriomethoxy)-11bH-benzo[a]quinolizin-2-one (PubChem CID 158668747) has the molecular formula C20H29NO3 and a molecular weight of 346.55 g/mol. Its IUPAC name is (3S,11bS)-1,1,3,4,4,6,6,7,7-nonadeuterio-3-(2,2-dimethylpropyl)-9,10-bis(trideuteriomethoxy)-11bH-benzo[a]quinolizin-2-one.
| Compound Name | (3S,11bS)-1,1,3,4,4,6,6,7,7-nonadeuterio-3-(2,2-dimethylpropyl)-9,10-bis(trideuteriomethoxy)-11bH-benzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 158668747 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 346.31 |
| IUPAC Name | (3S,11bS)-1,1,3,4,4,6,6,7,7-nonadeuterio-3-(2,2-dimethylpropyl)-9,10-bis(trideuteriomethoxy)-11bH-benzo[a]quinolizin-2-one |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1OC([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])N1[C@H]2C([2H])([2H])C(=O)[C@@]([2H])(CC(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C20H29NO3/c1-20(2,3)11-14-12-21-7-6-13-8-18(23-4)19(24-5)9-15(13)16(21)10-17(14)22/h8-9,14,16H,6-7,10-12H2,1-5H3/t14-,16-/m0/s1/i4D3,5D3,6D2,7D2,10D2,12D2,14D |
| InChIKey | XYALYQZFDHDDEI-KLRNOULFSA-N |
| XLogP | 3.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |