C20H32N2O2 — CID 146502958
3-(2,2-dimethylpropyl)-2-methyl-9,10-bis(trideuteriomethoxy)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline (PubChem CID 146502958) has the molecular formula C20H32N2O2 and a molecular weight of 338.52 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-2-methyl-9,10-bis(trideuteriomethoxy)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline.
| Compound Name | 3-(2,2-dimethylpropyl)-2-methyl-9,10-bis(trideuteriomethoxy)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 146502958 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-2-methyl-9,10-bis(trideuteriomethoxy)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1OC([2H])([2H])[2H])C1CN(C)C(CC(C)(C)C)CN1CC2 |
| InChI | InChI=1S/C20H32N2O2/c1-20(2,3)11-15-12-22-8-7-14-9-18(23-5)19(24-6)10-16(14)17(22)13-21(15)4/h9-10,15,17H,7-8,11-13H2,1-6H3/i5D3,6D3 |
| InChIKey | FFQQPLXULFRCRI-SCPKHUGHSA-N |
| XLogP | 3.35 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |