C24H36N2O2 — CID 153375157
(11bS)-9-(cyclobutylmethoxy)-3-(cyclobutylmethyl)-10-methoxy-2-methyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline (PubChem CID 153375157) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is (11bS)-9-(cyclobutylmethoxy)-3-(cyclobutylmethyl)-10-methoxy-2-methyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline.
| Compound Name | (11bS)-9-(cyclobutylmethoxy)-3-(cyclobutylmethyl)-10-methoxy-2-methyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 153375157 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | (11bS)-9-(cyclobutylmethoxy)-3-(cyclobutylmethyl)-10-methoxy-2-methyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline |
| SMILES | COc1cc2c(cc1OCC1CCC1)CCN1CC(CC3CCC3)N(C)C[C@H]21 |
| InChI | InChI=1S/C24H36N2O2/c1-25-15-22-21-13-23(27-2)24(28-16-18-7-4-8-18)12-19(21)9-10-26(22)14-20(25)11-17-5-3-6-17/h12-13,17-18,20,22H,3-11,14-16H2,1-2H3/t20?,22-/m1/s1 |
| InChIKey | UHWFMOYTIZFGPU-LWMIZPGFSA-N |
| XLogP | 4.28 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |