C24H37F3N2O2 — CID 142459489
(3R,11bS)-3-(2,2-dimethylpropyl)-10-methoxy-2-methyl-9-(5,5,5-trifluoropentoxy)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline (PubChem CID 142459489) has the molecular formula C24H37F3N2O2 and a molecular weight of 442.57 g/mol. Its IUPAC name is (3R,11bS)-3-(2,2-dimethylpropyl)-10-methoxy-2-methyl-9-(5,5,5-trifluoropentoxy)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline.
| Compound Name | (3R,11bS)-3-(2,2-dimethylpropyl)-10-methoxy-2-methyl-9-(5,5,5-trifluoropentoxy)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 142459489 |
| Molecular Formula | C24H37F3N2O2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | (3R,11bS)-3-(2,2-dimethylpropyl)-10-methoxy-2-methyl-9-(5,5,5-trifluoropentoxy)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline |
| SMILES | COc1cc2c(cc1OCCCCC(F)(F)F)CCN1C[C@@H](CC(C)(C)C)N(C)C[C@H]21 |
| InChI | InChI=1S/C24H37F3N2O2/c1-23(2,3)14-18-15-29-10-8-17-12-22(31-11-7-6-9-24(25,26)27)21(30-5)13-19(17)20(29)16-28(18)4/h12-13,18,20H,6-11,14-16H2,1-5H3/t18-,20-/m1/s1 |
| InChIKey | LCICDLKGBXBEGT-UYAOXDASSA-N |
| XLogP | 5.46 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|