C16H19F2NO3 — CID 157192928
1-[3-(2,4-difluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-6-methoxyhexan-2-one (PubChem CID 157192928) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-[3-(2,4-difluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-6-methoxyhexan-2-one.
| Compound Name | 1-[3-(2,4-difluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-6-methoxyhexan-2-one |
|---|---|
| PubChem CID | 157192928 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-[3-(2,4-difluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-6-methoxyhexan-2-one |
| SMILES | COCCCCC(=O)CC1CC(c2ccc(F)cc2F)=NO1 |
| InChI | InChI=1S/C16H19F2NO3/c1-21-7-3-2-4-12(20)9-13-10-16(19-22-13)14-6-5-11(17)8-15(14)18/h5-6,8,13H,2-4,7,9-10H2,1H3 |
| InChIKey | APXJIJYCXOJRBU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|