C46H66N14O6 — CID 157193279
4-butyl-N-methyl-3,5-bis[4-(1-methyltriazol-4-yl)butoxy]benzamide;4-butyl-N-methyl-3,5-bis[(1-methyltriazol-4-yl)methoxy]benzamide (PubChem CID 157193279) has the molecular formula C46H66N14O6 and a molecular weight of 911.13 g/mol. Its IUPAC name is 4-butyl-N-methyl-3,5-bis[4-(1-methyltriazol-4-yl)butoxy]benzamide;4-butyl-N-methyl-3,5-bis[(1-methyltriazol-4-yl)methoxy]benzamide.
| Compound Name | 4-butyl-N-methyl-3,5-bis[4-(1-methyltriazol-4-yl)butoxy]benzamide;4-butyl-N-methyl-3,5-bis[(1-methyltriazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 157193279 |
| Molecular Formula | C46H66N14O6 |
| Molecular Weight | 911.13 g/mol |
| Exact Mass | 910.53 |
| IUPAC Name | 4-butyl-N-methyl-3,5-bis[4-(1-methyltriazol-4-yl)butoxy]benzamide;4-butyl-N-methyl-3,5-bis[(1-methyltriazol-4-yl)methoxy]benzamide |
| SMILES | CCCCc1c(OCCCCc2cn(C)nn2)cc(C(=O)NC)cc1OCCCCc1cn(C)nn1.CCCCc1c(OCc2cn(C)nn2)cc(C(=O)NC)cc1OCc1cn(C)nn1 |
| InChI | InChI=1S/C26H39N7O3.C20H27N7O3/c1-5-6-13-23-24(35-14-9-7-11-21-18-32(3)30-28-21)16-20(26(34)27-2)17-25(23)36-15-10-8-12-22-19-33(4)31-29-22;1-5-6-7-17-18(29-12-15-10-26(3)24-22-15)8-14(20(28)21-2)9-19(17)30-13-16-11-27(4)25-23-16/h16-19H,5-15H2,1-4H3,(H,27,34);8-11H,5-7,12-13H2,1-4H3,(H,21,28) |
| InChIKey | APYHWIBCDVIPAH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 217.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.13 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|