C26H30O6 — CID 15719490
5-hydroxy-2-(4-hydroxy-2-methoxyphenyl)-8,8-dimethyl-9-(3-methylbut-2-enyl)-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one (PubChem CID 15719490) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 5-hydroxy-2-(4-hydroxy-2-methoxyphenyl)-8,8-dimethyl-9-(3-methylbut-2-enyl)-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one.
| Compound Name | 5-hydroxy-2-(4-hydroxy-2-methoxyphenyl)-8,8-dimethyl-9-(3-methylbut-2-enyl)-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 15719490 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 5-hydroxy-2-(4-hydroxy-2-methoxyphenyl)-8,8-dimethyl-9-(3-methylbut-2-enyl)-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one |
| SMILES | COc1cc(O)ccc1C1CC(=O)c2c(O)cc3c(c2O1)CC(CC=C(C)C)C(C)(C)O3 |
| InChI | InChI=1S/C26H30O6/c1-14(2)6-7-15-10-18-23(32-26(15,3)4)13-20(29)24-19(28)12-22(31-25(18)24)17-9-8-16(27)11-21(17)30-5/h6,8-9,11,13,15,22,27,29H,7,10,12H2,1-5H3 |
| InChIKey | QBFPWKGRQPYWRQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|