C48H50BrN7O6 — CID 157196789
tert-butyl N-[1-(4-bromophenyl)cyclobutyl]carbamate;N-[4-(1-methylcyclobutyl)phenyl]-3-nitro-6-phenylpyridin-2-amine;3-nitro-6-phenylpyridin-2-amine (PubChem CID 157196789) has the molecular formula C48H50BrN7O6 and a molecular weight of 900.88 g/mol. Its IUPAC name is tert-butyl N-[1-(4-bromophenyl)cyclobutyl]carbamate;N-[4-(1-methylcyclobutyl)phenyl]-3-nitro-6-phenylpyridin-2-amine;3-nitro-6-phenylpyridin-2-amine.
| Compound Name | tert-butyl N-[1-(4-bromophenyl)cyclobutyl]carbamate;N-[4-(1-methylcyclobutyl)phenyl]-3-nitro-6-phenylpyridin-2-amine;3-nitro-6-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 157196789 |
| Molecular Formula | C48H50BrN7O6 |
| Molecular Weight | 900.88 g/mol |
| Exact Mass | 899.30 |
| IUPAC Name | tert-butyl N-[1-(4-bromophenyl)cyclobutyl]carbamate;N-[4-(1-methylcyclobutyl)phenyl]-3-nitro-6-phenylpyridin-2-amine;3-nitro-6-phenylpyridin-2-amine |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(Br)cc2)CCC1.CC1(c2ccc(Nc3nc(-c4ccccc4)ccc3[N+](=O)[O-])cc2)CCC1.Nc1nc(-c2ccccc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H21N3O2.C15H20BrNO2.C11H9N3O2/c1-22(14-5-15-22)17-8-10-18(11-9-17)23-21-20(25(26)27)13-12-19(24-21)16-6-3-2-4-7-16;1-14(2,3)19-13(18)17-15(9-4-10-15)11-5-7-12(16)8-6-11;12-11-10(14(15)16)7-6-9(13-11)8-4-2-1-3-5-8/h2-4,6-13H,5,14-15H2,1H3,(H,23,24);5-8H,4,9-10H2,1-3H3,(H,17,18);1-7H,(H2,12,13) |
| InChIKey | AQILJVDANKKPGR-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 188.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.88 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|