C24H31N3O3 — CID 157199901
(2R)-1-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxy-6-propoxyhexan-2-ol (PubChem CID 157199901) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2R)-1-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxy-6-propoxyhexan-2-ol.
| Compound Name | (2R)-1-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxy-6-propoxyhexan-2-ol |
|---|---|
| PubChem CID | 157199901 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (2R)-1-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxy-6-propoxyhexan-2-ol |
| SMILES | CCCOCCCC[C@@H](O)COc1ccc2nc(-c3ccc(NC)nc3)ccc2c1 |
| InChI | InChI=1S/C24H31N3O3/c1-3-13-29-14-5-4-6-20(28)17-30-21-9-11-22-18(15-21)7-10-23(27-22)19-8-12-24(25-2)26-16-19/h7-12,15-16,20,28H,3-6,13-14,17H2,1-2H3,(H,25,26)/t20-/m1/s1 |
| InChIKey | AQRHKNKOERAGPY-HXUWFJFHSA-N |
| XLogP | 4.68 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|