C29H31N3O4 — CID 19362455
1-[4-[4,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-yl]phenoxy]hexan-2-ol (PubChem CID 19362455) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 1-[4-[4,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-yl]phenoxy]hexan-2-ol.
| Compound Name | 1-[4-[4,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-yl]phenoxy]hexan-2-ol |
|---|---|
| PubChem CID | 19362455 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 1-[4-[4,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-yl]phenoxy]hexan-2-ol |
| SMILES | CCCCC(O)COc1ccc(-c2nc(-c3ccc(OC)cc3)nc(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C29H31N3O4/c1-4-5-6-23(33)19-36-26-17-11-22(12-18-26)29-31-27(20-7-13-24(34-2)14-8-20)30-28(32-29)21-9-15-25(35-3)16-10-21/h7-18,23,33H,4-6,19H2,1-3H3 |
| InChIKey | UQKBDDHTGORSED-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |